[2-(4-chlorophenyl)quinolin-4-yl](4-methylpiperazin-1-yl)methanone
Chemical Structure Depiction of
[2-(4-chlorophenyl)quinolin-4-yl](4-methylpiperazin-1-yl)methanone
[2-(4-chlorophenyl)quinolin-4-yl](4-methylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | Y200-3065 |
| Compound Name: | [2-(4-chlorophenyl)quinolin-4-yl](4-methylpiperazin-1-yl)methanone |
| Molecular Weight: | 365.86 |
| Molecular Formula: | C21 H20 Cl N3 O |
| Smiles: | CN1CCN(CC1)C(c1cc(c2ccc(cc2)[Cl])nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1943 |
| logD: | 4.0636 |
| logSw: | -4.534 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.4225 |
| InChI Key: | KAIFQEIKDKMCGS-UHFFFAOYSA-N |