1-{4-[4-(4-ethoxybenzene-1-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{4-[4-(4-ethoxybenzene-1-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
1-{4-[4-(4-ethoxybenzene-1-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | Y200-3295 |
| Compound Name: | 1-{4-[4-(4-ethoxybenzene-1-sulfonyl)piperazin-1-yl]phenyl}ethan-1-one |
| Molecular Weight: | 388.48 |
| Molecular Formula: | C20 H24 N2 O4 S |
| Smiles: | CCOc1ccc(cc1)S(N1CCN(CC1)c1ccc(cc1)C(C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0413 |
| logD: | 3.0413 |
| logSw: | -3.2405 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.16 |
| InChI Key: | IPVYQBKHXYTUSO-UHFFFAOYSA-N |