3-(4-methoxyphenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide
3-(4-methoxyphenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide
Compound characteristics
| Compound ID: | Y200-3308 |
| Compound Name: | 3-(4-methoxyphenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| Molecular Weight: | 326.42 |
| Molecular Formula: | C18 H18 N2 O2 S |
| Smiles: | Cc1ccc2c(c1)sc(NC(CCc1ccc(cc1)OC)=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 4.5376 |
| logD: | 4.5375 |
| logSw: | -4.3593 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.421 |
| InChI Key: | LKTQXGVIXPICDN-UHFFFAOYSA-N |