2-(2-chloro-4-fluorobenzamido)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide
Chemical Structure Depiction of
2-(2-chloro-4-fluorobenzamido)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide
2-(2-chloro-4-fluorobenzamido)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide
Compound characteristics
| Compound ID: | Y200-3458 |
| Compound Name: | 2-(2-chloro-4-fluorobenzamido)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| Molecular Weight: | 341.79 |
| Molecular Formula: | C14 H13 Cl F N3 O2 S |
| Smiles: | Cc1c(C(N(C)C)=O)sc(NC(c2ccc(cc2[Cl])F)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.5293 |
| logD: | 0.4627 |
| logSw: | -3.734 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.953 |
| InChI Key: | VILJJTKBYJODBO-UHFFFAOYSA-N |