2-(3,4-dimethylphenyl)-N-(1,5-dimethyl-1H-pyrazol-3-yl)-8-methylquinoline-4-carboxamide
Chemical Structure Depiction of
2-(3,4-dimethylphenyl)-N-(1,5-dimethyl-1H-pyrazol-3-yl)-8-methylquinoline-4-carboxamide
2-(3,4-dimethylphenyl)-N-(1,5-dimethyl-1H-pyrazol-3-yl)-8-methylquinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y200-4241 |
| Compound Name: | 2-(3,4-dimethylphenyl)-N-(1,5-dimethyl-1H-pyrazol-3-yl)-8-methylquinoline-4-carboxamide |
| Molecular Weight: | 384.48 |
| Molecular Formula: | C24 H24 N4 O |
| Smiles: | Cc1ccc(cc1C)c1cc(C(Nc2cc(C)n(C)n2)=O)c2cccc(C)c2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6665 |
| logD: | 5.6601 |
| logSw: | -5.7404 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.213 |
| InChI Key: | BBIRZWXTSVNOOZ-UHFFFAOYSA-N |