methyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}-4-methyl-1,3-thiazole-5-carboxylate
Chemical Structure Depiction of
methyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}-4-methyl-1,3-thiazole-5-carboxylate
methyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}-4-methyl-1,3-thiazole-5-carboxylate
Compound characteristics
| Compound ID: | Y200-5315 |
| Compound Name: | methyl 2-{[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino}-4-methyl-1,3-thiazole-5-carboxylate |
| Molecular Weight: | 391.83 |
| Molecular Formula: | C17 H14 Cl N3 O4 S |
| Smiles: | Cc1c(C(=O)OC)sc(NC(c2c(c3ccccc3[Cl])noc2C)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.6518 |
| logD: | 2.8351 |
| logSw: | -4.3579 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.087 |
| InChI Key: | KAFSMZLRRYZIJZ-UHFFFAOYSA-N |