methyl 5-methyl-4-(4-methylphenyl)-2-{3-[(propan-2-yl)oxy]benzamido}thiophene-3-carboxylate
Chemical Structure Depiction of
methyl 5-methyl-4-(4-methylphenyl)-2-{3-[(propan-2-yl)oxy]benzamido}thiophene-3-carboxylate
methyl 5-methyl-4-(4-methylphenyl)-2-{3-[(propan-2-yl)oxy]benzamido}thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y200-6349 |
| Compound Name: | methyl 5-methyl-4-(4-methylphenyl)-2-{3-[(propan-2-yl)oxy]benzamido}thiophene-3-carboxylate |
| Molecular Weight: | 423.53 |
| Molecular Formula: | C24 H25 N O4 S |
| Smiles: | CC(C)Oc1cccc(c1)C(Nc1c(C(=O)OC)c(c2ccc(C)cc2)c(C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7905 |
| logD: | 5.1825 |
| logSw: | -5.5959 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.829 |
| InChI Key: | JSQWZTRKKLQHNK-UHFFFAOYSA-N |