N-(2,4-difluorophenyl)-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide
N-(2,4-difluorophenyl)-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y202-7300 |
| Compound Name: | N-(2,4-difluorophenyl)-2-(2,4-dimethoxyphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 420.41 |
| Molecular Formula: | C24 H18 F2 N2 O3 |
| Smiles: | COc1ccc(c(c1)OC)c1cc(C(Nc2ccc(cc2F)F)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.4044 |
| logD: | 5.398 |
| logSw: | -5.7486 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.865 |
| InChI Key: | SFLHAODIOYDUKA-UHFFFAOYSA-N |