2-(2-chloro-6-fluorophenyl)-1-[4-(diphenylmethyl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(2-chloro-6-fluorophenyl)-1-[4-(diphenylmethyl)piperazin-1-yl]ethan-1-one
2-(2-chloro-6-fluorophenyl)-1-[4-(diphenylmethyl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | Y202-7372 |
| Compound Name: | 2-(2-chloro-6-fluorophenyl)-1-[4-(diphenylmethyl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 422.93 |
| Molecular Formula: | C25 H24 Cl F N2 O |
| Smiles: | C(C(N1CCN(CC1)C(c1ccccc1)c1ccccc1)=O)c1c(cccc1[Cl])F |
| Stereo: | ACHIRAL |
| logP: | 5.3034 |
| logD: | 5.3003 |
| logSw: | -6.0082 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 18.9207 |
| InChI Key: | WLTSAVQFRRRQMG-UHFFFAOYSA-N |