N-[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]-1-methyl-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
N-[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]-1-methyl-1H-pyrazole-5-carboxamide
N-[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]-1-methyl-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | Y203-3382 |
| Compound Name: | N-[3-(cyclopentylcarbamoyl)-4-ethyl-5-methylthiophen-2-yl]-1-methyl-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 360.48 |
| Molecular Formula: | C18 H24 N4 O2 S |
| Smiles: | CCc1c(C(NC2CCCC2)=O)c(NC(c2ccnn2C)=O)sc1C |
| Stereo: | ACHIRAL |
| logP: | 2.8028 |
| logD: | 0.6084 |
| logSw: | -3.342 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.279 |
| InChI Key: | KKWGLMPTJZVBIB-UHFFFAOYSA-N |