N-(4,6-dimethylpyridin-2-yl)-3-fluorobenzamide
Chemical Structure Depiction of
N-(4,6-dimethylpyridin-2-yl)-3-fluorobenzamide
N-(4,6-dimethylpyridin-2-yl)-3-fluorobenzamide
Compound characteristics
| Compound ID: | Y203-5174 |
| Compound Name: | N-(4,6-dimethylpyridin-2-yl)-3-fluorobenzamide |
| Molecular Weight: | 244.27 |
| Molecular Formula: | C14 H13 F N2 O |
| Smiles: | Cc1cc(C)nc(c1)NC(c1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2688 |
| logD: | 3.2491 |
| logSw: | -3.3541 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.319 |
| InChI Key: | STINSGZBMAOWLU-UHFFFAOYSA-N |