3-fluoro-N-(3-fluorophenyl)benzamide
Chemical Structure Depiction of
3-fluoro-N-(3-fluorophenyl)benzamide
3-fluoro-N-(3-fluorophenyl)benzamide
Compound characteristics
| Compound ID: | Y203-5186 |
| Compound Name: | 3-fluoro-N-(3-fluorophenyl)benzamide |
| Molecular Weight: | 233.21 |
| Molecular Formula: | C13 H9 F2 N O |
| Smiles: | c1cc(cc(c1)F)C(Nc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.297 |
| logD: | 3.2585 |
| logSw: | -3.5633 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3296 |
| InChI Key: | VIVBHJXHYLJHDJ-UHFFFAOYSA-N |