2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-(2,4-dichlorophenyl)acetamide
Chemical Structure Depiction of
2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-(2,4-dichlorophenyl)acetamide
2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-(2,4-dichlorophenyl)acetamide
Compound characteristics
| Compound ID: | Y203-5461 |
| Compound Name: | 2-[(1,3-benzothiazol-2-yl)sulfanyl]-N-(2,4-dichlorophenyl)acetamide |
| Molecular Weight: | 369.29 |
| Molecular Formula: | C15 H10 Cl2 N2 O S2 |
| Smiles: | C(C(Nc1ccc(cc1[Cl])[Cl])=O)Sc1nc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 5.1411 |
| logD: | 5.1333 |
| logSw: | -5.6735 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.4999 |
| InChI Key: | RRCRZGCVQZTAJI-UHFFFAOYSA-N |