naphthalen-2-yl 3,4-dimethoxybenzoate
Chemical Structure Depiction of
naphthalen-2-yl 3,4-dimethoxybenzoate
naphthalen-2-yl 3,4-dimethoxybenzoate
Compound characteristics
| Compound ID: | Y203-5475 |
| Compound Name: | naphthalen-2-yl 3,4-dimethoxybenzoate |
| Molecular Weight: | 308.33 |
| Molecular Formula: | C19 H16 O4 |
| Smiles: | COc1ccc(cc1OC)C(=O)Oc1ccc2ccccc2c1 |
| Stereo: | ACHIRAL |
| logP: | 3.8968 |
| logD: | 3.8968 |
| logSw: | -4.2399 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.605 |
| InChI Key: | JYIBGJAWSTXRJZ-UHFFFAOYSA-N |