2,4-dichloro-N-(4-sulfamoylphenyl)benzamide
Chemical Structure Depiction of
2,4-dichloro-N-(4-sulfamoylphenyl)benzamide
2,4-dichloro-N-(4-sulfamoylphenyl)benzamide
Compound characteristics
| Compound ID: | Y203-5510 |
| Compound Name: | 2,4-dichloro-N-(4-sulfamoylphenyl)benzamide |
| Molecular Weight: | 345.2 |
| Molecular Formula: | C13 H10 Cl2 N2 O3 S |
| Smiles: | c1cc(ccc1NC(c1ccc(cc1[Cl])[Cl])=O)S(N)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5569 |
| logD: | 1.9299 |
| logSw: | -3.726 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 73.933 |
| InChI Key: | LGTFTTJXLPAIBX-UHFFFAOYSA-N |