N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenoxybutanamide
Chemical Structure Depiction of
N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenoxybutanamide
N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenoxybutanamide
Compound characteristics
| Compound ID: | Y203-6024 |
| Compound Name: | N-(6-methyl-1,3-benzothiazol-2-yl)-2-phenoxybutanamide |
| Molecular Weight: | 326.42 |
| Molecular Formula: | C18 H18 N2 O2 S |
| Smiles: | CCC(C(Nc1nc2ccc(C)cc2s1)=O)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1197 |
| logD: | 5.1196 |
| logSw: | -4.9305 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.763 |
| InChI Key: | ZGWIFYYJEIUPRL-HNNXBMFYSA-N |