4-bromo-N-(1-phenylethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-bromo-N-(1-phenylethyl)benzene-1-sulfonamide
4-bromo-N-(1-phenylethyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y203-6418 |
| Compound Name: | 4-bromo-N-(1-phenylethyl)benzene-1-sulfonamide |
| Molecular Weight: | 340.24 |
| Molecular Formula: | C14 H14 Br N O2 S |
| Smiles: | CC(c1ccccc1)NS(c1ccc(cc1)[Br])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0695 |
| logD: | 4.0692 |
| logSw: | -4.0955 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.373 |
| InChI Key: | WJQPTAVUAWEPCK-NSHDSACASA-N |