2-{[4-(methoxycarbonyl)phenyl]carbamoyl}cyclohexane-1-carboxylic acid
Chemical Structure Depiction of
2-{[4-(methoxycarbonyl)phenyl]carbamoyl}cyclohexane-1-carboxylic acid
2-{[4-(methoxycarbonyl)phenyl]carbamoyl}cyclohexane-1-carboxylic acid
Compound characteristics
| Compound ID: | Y203-6631 |
| Compound Name: | 2-{[4-(methoxycarbonyl)phenyl]carbamoyl}cyclohexane-1-carboxylic acid |
| Molecular Weight: | 305.33 |
| Molecular Formula: | C16 H19 N O5 |
| Smiles: | COC(c1ccc(cc1)NC(C1CCCCC1C(O)=O)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.2877 |
| logD: | -0.363 |
| logSw: | -2.9007 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.104 |
| InChI Key: | TZABEFQPIFZSDQ-UHFFFAOYSA-N |