N-(3,5-dichlorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-(3,5-dichlorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
N-(3,5-dichlorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y203-6763 |
| Compound Name: | N-(3,5-dichlorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 421.32 |
| Molecular Formula: | C24 H18 Cl2 N2 O |
| Smiles: | Cc1ccc(cc1)c1c(C)c(C(Nc2cc(cc(c2)[Cl])[Cl])=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 7.4385 |
| logD: | 7.4128 |
| logSw: | -6.5366 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.159 |
| InChI Key: | KZPKAOSCOWTFSU-UHFFFAOYSA-N |