N-(4-fluorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
					Chemical Structure Depiction of
N-(4-fluorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
			N-(4-fluorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y203-6956 | 
| Compound Name: | N-(4-fluorophenyl)-3-methyl-2-(4-methylphenyl)quinoline-4-carboxamide | 
| Molecular Weight: | 370.43 | 
| Molecular Formula: | C24 H19 F N2 O | 
| Smiles: | Cc1ccc(cc1)c1c(C)c(C(Nc2ccc(cc2)F)=O)c2ccccc2n1 | 
| Stereo: | ACHIRAL | 
| logP: | 5.9371 | 
| logD: | 5.9368 | 
| logSw: | -5.8977 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 32.159 | 
| InChI Key: | CSHWJQJRSOQUMM-UHFFFAOYSA-N | 
 
				 
				