N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-4-nitrobenzamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-4-nitrobenzamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-4-nitrobenzamide
Compound characteristics
| Compound ID: | Y203-6979 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-methyl-4-nitrobenzamide |
| Molecular Weight: | 344.37 |
| Molecular Formula: | C18 H20 N2 O5 |
| Smiles: | Cc1cc(ccc1[N+]([O-])=O)C(NCCc1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5556 |
| logD: | 2.5556 |
| logSw: | -2.8073 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.835 |
| InChI Key: | BADQIKJTTFPFML-UHFFFAOYSA-N |