methyl 3-{[2-(thiophen-2-yl)quinoline-4-carbonyl]amino}thiophene-2-carboxylate
Chemical Structure Depiction of
methyl 3-{[2-(thiophen-2-yl)quinoline-4-carbonyl]amino}thiophene-2-carboxylate
methyl 3-{[2-(thiophen-2-yl)quinoline-4-carbonyl]amino}thiophene-2-carboxylate
Compound characteristics
| Compound ID: | Y203-7514 |
| Compound Name: | methyl 3-{[2-(thiophen-2-yl)quinoline-4-carbonyl]amino}thiophene-2-carboxylate |
| Molecular Weight: | 394.47 |
| Molecular Formula: | C20 H14 N2 O3 S2 |
| Smiles: | COC(c1c(ccs1)NC(c1cc(c2cccs2)nc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8162 |
| logD: | 4.7925 |
| logSw: | -4.8273 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.902 |
| InChI Key: | MVSRNCZQRYIUBO-UHFFFAOYSA-N |