5-[([1,1'-biphenyl]-4-carbonyl)amino]-4-cyano-N,N-diethyl-3-methylthiophene-2-carboxamide
Chemical Structure Depiction of
5-[([1,1'-biphenyl]-4-carbonyl)amino]-4-cyano-N,N-diethyl-3-methylthiophene-2-carboxamide
5-[([1,1'-biphenyl]-4-carbonyl)amino]-4-cyano-N,N-diethyl-3-methylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y203-7645 |
| Compound Name: | 5-[([1,1'-biphenyl]-4-carbonyl)amino]-4-cyano-N,N-diethyl-3-methylthiophene-2-carboxamide |
| Molecular Weight: | 417.53 |
| Molecular Formula: | C24 H23 N3 O2 S |
| Smiles: | CCN(CC)C(c1c(C)c(C#N)c(NC(c2ccc(cc2)c2ccccc2)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5407 |
| logD: | 2.6042 |
| logSw: | -4.5181 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.841 |
| InChI Key: | CACWHIYQEREOMZ-UHFFFAOYSA-N |