N-(2-bromo-4-methylphenyl)-N'-(4-chlorophenyl)urea
Chemical Structure Depiction of
N-(2-bromo-4-methylphenyl)-N'-(4-chlorophenyl)urea
N-(2-bromo-4-methylphenyl)-N'-(4-chlorophenyl)urea
Compound characteristics
| Compound ID: | Y203-8395 |
| Compound Name: | N-(2-bromo-4-methylphenyl)-N'-(4-chlorophenyl)urea |
| Molecular Weight: | 339.62 |
| Molecular Formula: | C14 H12 Br Cl N2 O |
| Smiles: | Cc1ccc(c(c1)[Br])NC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.0485 |
| logD: | 5.0483 |
| logSw: | -5.0899 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 31.844 |
| InChI Key: | IJMNDTSCUAZHRX-UHFFFAOYSA-N |