6-ethyl-2-(4-methoxybenzamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
6-ethyl-2-(4-methoxybenzamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
6-ethyl-2-(4-methoxybenzamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | Y203-8482 |
| Compound Name: | 6-ethyl-2-(4-methoxybenzamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 358.46 |
| Molecular Formula: | C19 H22 N2 O3 S |
| Smiles: | CCC1CCc2c(C(N)=O)c(NC(c3ccc(cc3)OC)=O)sc2C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9561 |
| logD: | 1.6728 |
| logSw: | -3.5631 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.647 |
| InChI Key: | PPVXGCCIFUTVJL-LLVKDONJSA-N |