N-cyclohexyl-N'-(2,4-dimethylphenyl)urea
Chemical Structure Depiction of
N-cyclohexyl-N'-(2,4-dimethylphenyl)urea
N-cyclohexyl-N'-(2,4-dimethylphenyl)urea
Compound characteristics
| Compound ID: | Y203-8800 |
| Compound Name: | N-cyclohexyl-N'-(2,4-dimethylphenyl)urea |
| Molecular Weight: | 246.35 |
| Molecular Formula: | C15 H22 N2 O |
| Smiles: | Cc1ccc(c(C)c1)NC(NC1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7673 |
| logD: | 3.7673 |
| logSw: | -3.7548 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.891 |
| InChI Key: | KOHHTUXCTXMWKY-UHFFFAOYSA-N |