N-[2-(cyclohex-1-en-1-yl)ethyl]-2,6-dimethoxybenzamide
Chemical Structure Depiction of
N-[2-(cyclohex-1-en-1-yl)ethyl]-2,6-dimethoxybenzamide
N-[2-(cyclohex-1-en-1-yl)ethyl]-2,6-dimethoxybenzamide
Compound characteristics
| Compound ID: | Y203-8822 |
| Compound Name: | N-[2-(cyclohex-1-en-1-yl)ethyl]-2,6-dimethoxybenzamide |
| Molecular Weight: | 289.37 |
| Molecular Formula: | C17 H23 N O3 |
| Smiles: | COc1cccc(c1C(NCCC1CCCCC=1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.3866 |
| logD: | 2.3865 |
| logSw: | -2.6981 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.946 |
| InChI Key: | XLRGYLYQOKFAIG-UHFFFAOYSA-N |