1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one
Chemical Structure Depiction of
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one
Compound characteristics
| Compound ID: | Y203-8981 |
| Compound Name: | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one |
| Molecular Weight: | 413.73 |
| Molecular Formula: | C19 H19 Cl3 N2 O2 |
| Smiles: | CC(C(N1CCN(CC1)c1cccc(c1)[Cl])=O)Oc1ccc(cc1[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0967 |
| logD: | 5.0967 |
| logSw: | -5.4446 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 27.0227 |
| InChI Key: | RUMDUZKXHKJOMD-ZDUSSCGKSA-N |