N-[4-(dimethylamino)phenyl]-3,3-diphenylpropanamide
Chemical Structure Depiction of
N-[4-(dimethylamino)phenyl]-3,3-diphenylpropanamide
N-[4-(dimethylamino)phenyl]-3,3-diphenylpropanamide
Compound characteristics
| Compound ID: | Y203-9318 |
| Compound Name: | N-[4-(dimethylamino)phenyl]-3,3-diphenylpropanamide |
| Molecular Weight: | 344.46 |
| Molecular Formula: | C23 H24 N2 O |
| Smiles: | CN(C)c1ccc(cc1)NC(CC(c1ccccc1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9308 |
| logD: | 4.9222 |
| logSw: | -4.5503 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.6494 |
| InChI Key: | UHESWRHLSQVRNM-UHFFFAOYSA-N |