N-(4-chlorophenyl)-N'-cyclopropylurea
Chemical Structure Depiction of
N-(4-chlorophenyl)-N'-cyclopropylurea
N-(4-chlorophenyl)-N'-cyclopropylurea
Compound characteristics
| Compound ID: | Y203-9534 |
| Compound Name: | N-(4-chlorophenyl)-N'-cyclopropylurea |
| Molecular Weight: | 210.66 |
| Molecular Formula: | C10 H11 Cl N2 O |
| Smiles: | C1CC1NC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.4943 |
| logD: | 2.4943 |
| logSw: | -3.2382 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 33.92 |
| InChI Key: | NAWINKOQQUXUFD-UHFFFAOYSA-N |