N-[2-(3-chlorophenyl)ethyl][1,1'-biphenyl]-4-carboxamide
Chemical Structure Depiction of
N-[2-(3-chlorophenyl)ethyl][1,1'-biphenyl]-4-carboxamide
N-[2-(3-chlorophenyl)ethyl][1,1'-biphenyl]-4-carboxamide
Compound characteristics
| Compound ID: | Y203-9771 |
| Compound Name: | N-[2-(3-chlorophenyl)ethyl][1,1'-biphenyl]-4-carboxamide |
| Molecular Weight: | 335.83 |
| Molecular Formula: | C21 H18 Cl N O |
| Smiles: | C(CNC(c1ccc(cc1)c1ccccc1)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9386 |
| logD: | 4.9386 |
| logSw: | -5.2569 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.2217 |
| InChI Key: | UWCVZMXTANJZNP-UHFFFAOYSA-N |