N-(3-chlorophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)urea
Chemical Structure Depiction of
N-(3-chlorophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)urea
N-(3-chlorophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)urea
Compound characteristics
| Compound ID: | Y204-0066 |
| Compound Name: | N-(3-chlorophenyl)-N'-(4-methyl-1,3-thiazol-2-yl)urea |
| Molecular Weight: | 267.73 |
| Molecular Formula: | C11 H10 Cl N3 O S |
| Smiles: | Cc1csc(NC(Nc2cccc(c2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.9207 |
| logD: | 3.9128 |
| logSw: | -4.2472 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.394 |
| InChI Key: | SZPQTSUDPDNCAK-UHFFFAOYSA-N |