(5-bromofuran-2-yl)(4-ethylpiperazin-1-yl)methanone
Chemical Structure Depiction of
(5-bromofuran-2-yl)(4-ethylpiperazin-1-yl)methanone
(5-bromofuran-2-yl)(4-ethylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | Y204-0328 |
| Compound Name: | (5-bromofuran-2-yl)(4-ethylpiperazin-1-yl)methanone |
| Molecular Weight: | 287.15 |
| Molecular Formula: | C11 H15 Br N2 O2 |
| Smiles: | CCN1CCN(CC1)C(c1ccc(o1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 1.5357 |
| logD: | 1.3633 |
| logSw: | -1.8976 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.3493 |
| InChI Key: | IBXCOVGYANMDHB-UHFFFAOYSA-N |