3-[(2-methoxy-5-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Chemical Structure Depiction of
3-[(2-methoxy-5-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
3-[(2-methoxy-5-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Compound characteristics
| Compound ID: | Y204-0542 |
| Compound Name: | 3-[(2-methoxy-5-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| Molecular Weight: | 301.34 |
| Molecular Formula: | C17 H19 N O4 |
| Smiles: | Cc1ccc(c(c1)NC(C1C2CC(C=C2)C1C(O)=O)=O)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.2778 |
| logD: | -0.0474 |
| logSw: | -2.7457 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.515 |
| InChI Key: | XKAKQQOHKFSFDM-UHFFFAOYSA-N |