N-(2-carbamoylphenyl)-2-methylfuran-3-carboxamide
Chemical Structure Depiction of
N-(2-carbamoylphenyl)-2-methylfuran-3-carboxamide
N-(2-carbamoylphenyl)-2-methylfuran-3-carboxamide
Compound characteristics
| Compound ID: | Y204-0731 |
| Compound Name: | N-(2-carbamoylphenyl)-2-methylfuran-3-carboxamide |
| Molecular Weight: | 244.25 |
| Molecular Formula: | C13 H12 N2 O3 |
| Smiles: | Cc1c(cco1)C(Nc1ccccc1C(N)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2065 |
| logD: | 1.2048 |
| logSw: | -2.1033 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.924 |
| InChI Key: | ZJMMRBIXAYFSIL-UHFFFAOYSA-N |