2-(4-chloro-2-methylphenoxy)-N-[(pyridin-2-yl)methyl]propanamide
Chemical Structure Depiction of
2-(4-chloro-2-methylphenoxy)-N-[(pyridin-2-yl)methyl]propanamide
2-(4-chloro-2-methylphenoxy)-N-[(pyridin-2-yl)methyl]propanamide
Compound characteristics
| Compound ID: | Y204-0770 |
| Compound Name: | 2-(4-chloro-2-methylphenoxy)-N-[(pyridin-2-yl)methyl]propanamide |
| Molecular Weight: | 304.77 |
| Molecular Formula: | C16 H17 Cl N2 O2 |
| Smiles: | CC(C(NCc1ccccn1)=O)Oc1ccc(cc1C)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3684 |
| logD: | 3.3681 |
| logSw: | -3.4406 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.07 |
| InChI Key: | QBOAUGCBVRLDHK-LBPRGKRZSA-N |