N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazine-2-carboxamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazine-2-carboxamide
N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazine-2-carboxamide
Compound characteristics
| Compound ID: | Y204-1135 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]pyrazine-2-carboxamide |
| Molecular Weight: | 287.32 |
| Molecular Formula: | C15 H17 N3 O3 |
| Smiles: | COc1ccc(CCNC(c2cnccn2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 0.5014 |
| logD: | 0.5014 |
| logSw: | -1.4396 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.32 |
| InChI Key: | MWQWBNQNVWBHLY-UHFFFAOYSA-N |