6-[(2,5-dimethoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid
Chemical Structure Depiction of
6-[(2,5-dimethoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid
6-[(2,5-dimethoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid
Compound characteristics
| Compound ID: | Y204-1144 |
| Compound Name: | 6-[(2,5-dimethoxyphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| Molecular Weight: | 305.33 |
| Molecular Formula: | C16 H19 N O5 |
| Smiles: | COc1ccc(c(c1)NC(C1CC=CCC1C(O)=O)=O)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.1046 |
| logD: | -0.2512 |
| logSw: | -2.8783 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.406 |
| InChI Key: | OMMCLSTYKQPZHQ-UHFFFAOYSA-N |