N-(3,4-dichlorophenyl)-N'-(2-methoxy-5-methylphenyl)urea
Chemical Structure Depiction of
N-(3,4-dichlorophenyl)-N'-(2-methoxy-5-methylphenyl)urea
N-(3,4-dichlorophenyl)-N'-(2-methoxy-5-methylphenyl)urea
Compound characteristics
| Compound ID: | Y204-1250 |
| Compound Name: | N-(3,4-dichlorophenyl)-N'-(2-methoxy-5-methylphenyl)urea |
| Molecular Weight: | 325.19 |
| Molecular Formula: | C15 H14 Cl2 N2 O2 |
| Smiles: | Cc1ccc(c(c1)NC(Nc1ccc(c(c1)[Cl])[Cl])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.9836 |
| logD: | 4.9835 |
| logSw: | -5.0785 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.474 |
| InChI Key: | WYVWUPNAGJQVBU-UHFFFAOYSA-N |