N-{4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl}-2-methylfuran-3-carboxamide
Chemical Structure Depiction of
N-{4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl}-2-methylfuran-3-carboxamide
N-{4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl}-2-methylfuran-3-carboxamide
Compound characteristics
| Compound ID: | Y204-1802 |
| Compound Name: | N-{4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl}-2-methylfuran-3-carboxamide |
| Molecular Weight: | 375.4 |
| Molecular Formula: | C17 H17 N3 O5 S |
| Smiles: | Cc1c(C)noc1NS(c1ccc(cc1)NC(c1ccoc1C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1894 |
| logD: | 0.1803 |
| logSw: | -3.0573 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 94.877 |
| InChI Key: | ZISKWQOROKXNJW-UHFFFAOYSA-N |