4-[(4-methylbenzene-1-sulfonyl)amino]benzamide
Chemical Structure Depiction of
4-[(4-methylbenzene-1-sulfonyl)amino]benzamide
4-[(4-methylbenzene-1-sulfonyl)amino]benzamide
Compound characteristics
| Compound ID: | Y204-2601 |
| Compound Name: | 4-[(4-methylbenzene-1-sulfonyl)amino]benzamide |
| Molecular Weight: | 290.34 |
| Molecular Formula: | C14 H14 N2 O3 S |
| Smiles: | Cc1ccc(cc1)S(Nc1ccc(cc1)C(N)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0353 |
| logD: | 1.1852 |
| logSw: | -2.8844 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 74.947 |
| InChI Key: | OEPGVBWEPKWNEP-UHFFFAOYSA-N |