N-(5-bromopyridin-2-yl)[1,1'-biphenyl]-4-carboxamide
Chemical Structure Depiction of
N-(5-bromopyridin-2-yl)[1,1'-biphenyl]-4-carboxamide
N-(5-bromopyridin-2-yl)[1,1'-biphenyl]-4-carboxamide
Compound characteristics
| Compound ID: | Y204-2721 |
| Compound Name: | N-(5-bromopyridin-2-yl)[1,1'-biphenyl]-4-carboxamide |
| Molecular Weight: | 353.22 |
| Molecular Formula: | C18 H13 Br N2 O |
| Smiles: | c1ccc(cc1)c1ccc(cc1)C(Nc1ccc(cn1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.3006 |
| logD: | 5.0833 |
| logSw: | -5.7183 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.763 |
| InChI Key: | QDXIXYCEOBQITN-UHFFFAOYSA-N |