2-(ethanesulfonyl)-1,2,3,4-tetrahydroisoquinoline
Chemical Structure Depiction of
2-(ethanesulfonyl)-1,2,3,4-tetrahydroisoquinoline
2-(ethanesulfonyl)-1,2,3,4-tetrahydroisoquinoline
Compound characteristics
| Compound ID: | Y204-3178 |
| Compound Name: | 2-(ethanesulfonyl)-1,2,3,4-tetrahydroisoquinoline |
| Molecular Weight: | 225.31 |
| Molecular Formula: | C11 H15 N O2 S |
| Smiles: | CCS(N1CCc2ccccc2C1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9789 |
| logD: | 1.9789 |
| logSw: | -2.3585 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.777 |
| InChI Key: | KGEJNOKRQODGQH-UHFFFAOYSA-N |