N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methylthiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methylthiophene-2-carboxamide
N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y204-5043 |
| Compound Name: | N-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methylthiophene-2-carboxamide |
| Molecular Weight: | 303.28 |
| Molecular Formula: | C13 H9 F4 N O S |
| Smiles: | Cc1ccc(C(Nc2cc(ccc2F)C(F)(F)F)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.8822 |
| logD: | 4.7848 |
| logSw: | -4.6514 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.6502 |
| InChI Key: | HDHLDDPDNLCXNA-UHFFFAOYSA-N |