N-(2-carbamoylphenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-(2-carbamoylphenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide
N-(2-carbamoylphenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | Y204-5081 |
| Compound Name: | N-(2-carbamoylphenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
| Molecular Weight: | 436.3 |
| Molecular Formula: | C23 H15 Cl2 N3 O2 |
| Smiles: | c1ccc(c(c1)C(N)=O)NC(c1cc(c2ccc(cc2[Cl])[Cl])nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2818 |
| logD: | 5.2817 |
| logSw: | -5.9361 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.75 |
| InChI Key: | JOPDIGJYIMGYCK-UHFFFAOYSA-N |