(2,5-dimethylpiperazine-1,4-diyl)bis[(thiophen-2-yl)methanone]
Chemical Structure Depiction of
(2,5-dimethylpiperazine-1,4-diyl)bis[(thiophen-2-yl)methanone]
(2,5-dimethylpiperazine-1,4-diyl)bis[(thiophen-2-yl)methanone]
Compound characteristics
| Compound ID: | Y204-5226 |
| Compound Name: | (2,5-dimethylpiperazine-1,4-diyl)bis[(thiophen-2-yl)methanone] |
| Molecular Weight: | 334.46 |
| Molecular Formula: | C16 H18 N2 O2 S2 |
| Smiles: | CC1CN(C(C)CN1C(c1cccs1)=O)C(c1cccs1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.9602 |
| logD: | 2.9602 |
| logSw: | -3.1136 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.816 |
| InChI Key: | VXWJEDBXCBRIOM-UHFFFAOYSA-N |