4-{[4-(4-tert-butylphenyl)-3-carbamoyl-5-methylthiophen-2-yl]amino}-4-oxobutanoic acid
Chemical Structure Depiction of
4-{[4-(4-tert-butylphenyl)-3-carbamoyl-5-methylthiophen-2-yl]amino}-4-oxobutanoic acid
4-{[4-(4-tert-butylphenyl)-3-carbamoyl-5-methylthiophen-2-yl]amino}-4-oxobutanoic acid
Compound characteristics
| Compound ID: | Y204-5315 |
| Compound Name: | 4-{[4-(4-tert-butylphenyl)-3-carbamoyl-5-methylthiophen-2-yl]amino}-4-oxobutanoic acid |
| Molecular Weight: | 388.48 |
| Molecular Formula: | C20 H24 N2 O4 S |
| Smiles: | Cc1c(c2ccc(cc2)C(C)(C)C)c(C(N)=O)c(NC(CCC(O)=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 2.4455 |
| logD: | -0.5039 |
| logSw: | -2.7949 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 85.353 |
| InChI Key: | RBDVPWPRWWFUES-UHFFFAOYSA-N |