2-methyl-N,N-bis(2-methylpropyl)furan-3-carboxamide
Chemical Structure Depiction of
2-methyl-N,N-bis(2-methylpropyl)furan-3-carboxamide
2-methyl-N,N-bis(2-methylpropyl)furan-3-carboxamide
Compound characteristics
| Compound ID: | Y204-5913 |
| Compound Name: | 2-methyl-N,N-bis(2-methylpropyl)furan-3-carboxamide |
| Molecular Weight: | 237.34 |
| Molecular Formula: | C14 H23 N O2 |
| Smiles: | CC(C)CN(CC(C)C)C(c1ccoc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3178 |
| logD: | 3.3178 |
| logSw: | -3.4737 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.9539 |
| InChI Key: | LSKFIVQTXLLUIP-UHFFFAOYSA-N |