2-methyl-N-(2-phenoxyphenyl)furan-3-carboxamide
Chemical Structure Depiction of
2-methyl-N-(2-phenoxyphenyl)furan-3-carboxamide
2-methyl-N-(2-phenoxyphenyl)furan-3-carboxamide
Compound characteristics
| Compound ID: | Y204-6714 |
| Compound Name: | 2-methyl-N-(2-phenoxyphenyl)furan-3-carboxamide |
| Molecular Weight: | 293.32 |
| Molecular Formula: | C18 H15 N O3 |
| Smiles: | Cc1c(cco1)C(Nc1ccccc1Oc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9575 |
| logD: | 3.9575 |
| logSw: | -4.1403 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.699 |
| InChI Key: | RLRQRWSVJNFTDG-UHFFFAOYSA-N |