N-{1-[(4-chlorophenyl)methyl]-1H-pyrazol-3-yl}-N'-(4-methylphenyl)urea
Chemical Structure Depiction of
N-{1-[(4-chlorophenyl)methyl]-1H-pyrazol-3-yl}-N'-(4-methylphenyl)urea
N-{1-[(4-chlorophenyl)methyl]-1H-pyrazol-3-yl}-N'-(4-methylphenyl)urea
Compound characteristics
| Compound ID: | Y205-0033 |
| Compound Name: | N-{1-[(4-chlorophenyl)methyl]-1H-pyrazol-3-yl}-N'-(4-methylphenyl)urea |
| Molecular Weight: | 340.81 |
| Molecular Formula: | C18 H17 Cl N4 O |
| Smiles: | Cc1ccc(cc1)NC(Nc1ccn(Cc2ccc(cc2)[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4669 |
| logD: | 4.4668 |
| logSw: | -4.679 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.497 |
| InChI Key: | GHQBPXCHXSSSQX-UHFFFAOYSA-N |